4-tert-butyl-1-(1-trimethylsilylcyclopropyl)cyclohexan-1-ol
4-tert-butyl-1-(1-trimethylsilylcyclopropyl)cyclohexan-1-ol structure
|
Common Name | 4-tert-butyl-1-(1-trimethylsilylcyclopropyl)cyclohexan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 89657-06-7 | Molecular Weight | 268.51000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H32OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-tert-butyl-1-(1-trimethylsilylcyclopropyl)cyclohexan-1-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H32OSi |
|---|---|
| Molecular Weight | 268.51000 |
| Exact Mass | 268.22200 |
| PSA | 20.23000 |
| LogP | 4.82620 |
| InChIKey | IQUWMUIVFOZORS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCC(O)(C2([Si](C)(C)C)CC2)CC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-tert-butyl-1-... CAS#:89657-06-7 |
| Literature: Cohen, Theodore; Sherbine, James P.; Matz, James R.; Hutchins, Robert R.; McHenry, Barry M.; Willey, Paul R. Journal of the American Chemical Society, 1984 , vol. 106, # 11 p. 3245 - 3252 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4-tert-butyl-1-(1-trimethylsilylcyclopropyl)cyclohexan-1-ol? |
| A: SMILES notation of 4-tert-butyl-1-(1-trimethylsilylcyclopropyl)cyclohexan-1-ol is CC(C)(C)C1CCC(O)(C2([Si](C)(C)C)CC2)CC1. |
| Q: What is the Chinese name of 89657-06-7? |
| A: Chinese name of 89657-06-7 is 89657-06-7. |
| Q: What is the molecular formula of 4-tert-butyl-1-(1-trimethylsilylcyclopropyl)cyclohexan-1-ol? |
| A: Molecular formula of 4-tert-butyl-1-(1-trimethylsilylcyclopropyl)cyclohexan-1-ol is C16H32OSi. |
| Q: What is the LogP of 4-tert-butyl-1-(1-trimethylsilylcyclopropyl)cyclohexan-1-ol? |
| A: LogP of 4-tert-butyl-1-(1-trimethylsilylcyclopropyl)cyclohexan-1-ol is 4.82620. |
| Q: What is the English name of 4-tert-butyl-1-(1-trimethylsilylcyclopropyl)cyclohexan-1-ol? |
| A: The English name of 4-tert-butyl-1-(1-trimethylsilylcyclopropyl)cyclohexan-1-ol is 4-tert-butyl-1-(1-trimethylsilylcyclopropyl)cyclohexan-1-ol. |
| Q: What is the molecular weight of 4-tert-butyl-1-(1-trimethylsilylcyclopropyl)cyclohexan-1-ol? |
| A: Molecular weight of 4-tert-butyl-1-(1-trimethylsilylcyclopropyl)cyclohexan-1-ol is 268.51000. |
| Q: What is the InChIKey of 4-tert-butyl-1-(1-trimethylsilylcyclopropyl)cyclohexan-1-ol? |
| A: InChIKey of 4-tert-butyl-1-(1-trimethylsilylcyclopropyl)cyclohexan-1-ol is IQUWMUIVFOZORS-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 4-tert-butyl-1-(1-trimethylsilylcyclopropyl)cyclohexan-1-ol? |
| A: Polar surface area (PSA) of 4-tert-butyl-1-(1-trimethylsilylcyclopropyl)cyclohexan-1-ol is 20.23000. |
| Q: What is the CAS number of 4-tert-butyl-1-(1-trimethylsilylcyclopropyl)cyclohexan-1-ol? |
| A: CAS number of 4-tert-butyl-1-(1-trimethylsilylcyclopropyl)cyclohexan-1-ol is 89657-06-7. |