4-tert-butyl-1-(1-trimethylsilylcyclopropyl)cyclohexan-1-ol structure
|
Common Name | 4-tert-butyl-1-(1-trimethylsilylcyclopropyl)cyclohexan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 89657-06-7 | Molecular Weight | 268.51000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H32OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-tert-butyl-1-(1-trimethylsilylcyclopropyl)cyclohexan-1-ol |
|---|
| Molecular Formula | C16H32OSi |
|---|---|
| Molecular Weight | 268.51000 |
| Exact Mass | 268.22200 |
| PSA | 20.23000 |
| LogP | 4.82620 |
| InChIKey | IQUWMUIVFOZORS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCC(O)(C2([Si](C)(C)C)CC2)CC1 |
|
~%
4-tert-butyl-1-... CAS#:89657-06-7 |
| Literature: Cohen, Theodore; Sherbine, James P.; Matz, James R.; Hutchins, Robert R.; McHenry, Barry M.; Willey, Paul R. Journal of the American Chemical Society, 1984 , vol. 106, # 11 p. 3245 - 3252 |