5-chloro-1-methyl-3-thiophen-3-ylbenzimidazol-2-one structure
|
Common Name | 5-chloro-1-methyl-3-thiophen-3-ylbenzimidazol-2-one | ||
|---|---|---|---|---|
| CAS Number | 89660-06-0 | Molecular Weight | 264.73100 | |
| Density | 1.448g/cm3 | Boiling Point | 410.5ºC at 760 mmHg | |
| Molecular Formula | C12H9ClN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.1ºC | |
| Name | 5-chloro-1-methyl-3-thiophen-3-ylbenzimidazol-2-one |
|---|
| Density | 1.448g/cm3 |
|---|---|
| Boiling Point | 410.5ºC at 760 mmHg |
| Molecular Formula | C12H9ClN2OS |
| Molecular Weight | 264.73100 |
| Flash Point | 202.1ºC |
| Exact Mass | 264.01200 |
| PSA | 55.17000 |
| LogP | 3.04410 |
| Index of Refraction | 1.677 |
| InChIKey | BLWVHRFHMJZEOT-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)n(-c2ccsc2)c2cc(Cl)ccc21 |
|
~12%
5-chloro-1-meth... CAS#:89660-06-0 |
| Literature: Bianchi; Butti; Rossi; et al. European Journal of Medicinal Chemistry, 1983 , vol. 18, # 6 p. 495 - 500 |