S1-QEL structure
|
Common Name | S1-QEL | ||
|---|---|---|---|---|
| CAS Number | 897613-29-5 | Molecular Weight | 436.527 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C23H24N4O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of S1-QELS1QEL is a suppressor of mitochondrial respiratory complex I site IQ electron leak which suppresses superoxide and/or H2O2 production without altering oxidative phosphorylation. |
| Name | S1QEL |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C23H24N4O3S |
| Molecular Weight | 436.527 |
| Exact Mass | 436.156921 |
| LogP | 4.01 |
| Index of Refraction | 1.653 |
| InChIKey | BFNBJUBXXJKBFN-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cccc(NC(=O)C(=O)NCCc2sc(-c3ccc(C)cc3)nc2C)c1 |
| S1QEL1.1 |
| N1-(3-acetamidophenyl)-N2-(2-(4-methyl-2-(p-tolyl)thiazol-5-yl)ethyl)oxalamide |
| S1QEL |
| Ethanediamide, N1-[3-(acetylamino)phenyl]-N2-[2-[4-methyl-2-(4-methylphenyl)-5-thiazolyl]ethyl]- |
| N-(3-Acetamidophenyl)-N'-{2-[4-methyl-2-(4-methylphenyl)-1,3-thiazol-5-yl]ethyl}ethanediamide |