musk ether structure
|
Common Name | musk ether | ||
|---|---|---|---|---|
| CAS Number | 89780-06-3 | Molecular Weight | 262.38700 | |
| Density | 0.982g/cm3 | Boiling Point | 378.5ºC at 760 mmHg | |
| Molecular Formula | C17H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.6ºC | |
| Name | 1-methoxy-3,5,5,8,8-pentamethyl-1,2,3,4-tetrahydronaphthalene-2-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 0.982g/cm3 |
|---|---|
| Boiling Point | 378.5ºC at 760 mmHg |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.38700 |
| Flash Point | 154.6ºC |
| Exact Mass | 262.19300 |
| PSA | 26.30000 |
| LogP | 3.77510 |
| Index of Refraction | 1.515 |
| InChIKey | WPUPOYSDTDHCGJ-UHFFFAOYSA-N |
| SMILES | COc1c(C=O)c(C)cc2c1C(C)(C)CCC2(C)C |
|
~%
musk ether CAS#:89780-06-3 |
| Literature: Fritzsche, Dodge and Olcott, Inc. Patent: US4476040 A1, 1984 ; |
| 1-methoxy-3,5,5,8,8-pentamethyl-5,6,7,8-tetrahydronaphthalene-2-carboxaldehyde |
| 2-formyl-1-methoxy-3,5,5,8,8-pentamethyl-5,6,7,8-tetrahydronaphthalene |
| 1-methoxy-3,5,5,8,8-pentamethyl-tetralin-2-carbaldehyde |
| 6-formyl-1,1,4,4,7-pentamethyl-5-methoxy-1,2,3,4-tetrahydro-naphthalene |
| 2-formyl-5,6,7,8-tetrahydro-1-methoxy-3,5,5,8,8-pentamethylnaphthalene |