23-hydroxytormentic acid structure
|
Common Name | 23-hydroxytormentic acid | ||
|---|---|---|---|---|
| CAS Number | 89786-84-5 | Molecular Weight | 504.70 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 639.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C30H48O6 | Melting Point | >300℃ | |
| MSDS | N/A | Flash Point | 354.5±28.0 °C | |
Use of 23-hydroxytormentic acidMyrianthic acid, a triterpenoid isolated from the root of Myrianthus arboreus, has anticancer activity[1]. |
| Name | 19α-hydroxyasiatic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Myrianthic acid, a triterpenoid isolated from the root of Myrianthus arboreus, has anticancer activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 639.3±55.0 °C at 760 mmHg |
| Melting Point | >300℃ |
| Molecular Formula | C30H48O6 |
| Molecular Weight | 504.70 |
| Flash Point | 354.5±28.0 °C |
| Exact Mass | 504.345093 |
| PSA | 118.22000 |
| LogP | 4.85 |
| Vapour Pressure | 0.0±4.3 mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | YCOKATFNRPZIIU-MGBZEVKYSA-N |
| SMILES | CC1CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O)C(O)C(C)(CO)C5CCC43C)C2C1(C)O |
| Hazard Codes | Xi |
|---|
| 23-hydroxytormentic acid |
| (2α,3β)-2,3,19,23-Tetrahydroxyurs-12-en-28-oic acid |