1-N,4-N-bis(4-amino-3-nitrophenyl)benzene-1,4-dicarboxamide
1-N,4-N-bis(4-amino-3-nitrophenyl)benzene-1,4-dicarboxamide structure
|
Common Name | 1-N,4-N-bis(4-amino-3-nitrophenyl)benzene-1,4-dicarboxamide | ||
|---|---|---|---|---|
| CAS Number | 89791-40-2 | Molecular Weight | 436.37800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H16N6O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-N,4-N-bis(4-amino-3-nitrophenyl)benzene-1,4-dicarboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H16N6O6 |
|---|---|
| Molecular Weight | 436.37800 |
| Exact Mass | 436.11300 |
| PSA | 201.88000 |
| LogP | 5.52680 |
| InChIKey | YQXFZHAREZIIFG-UHFFFAOYSA-N |
| SMILES | Nc1ccc(NC(=O)c2ccc(C(=O)Nc3ccc(N)c([N+](=O)[O-])c3)cc2)cc1[N+](=O)[O-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-N,4-N-bis(4-a... CAS#:89791-40-2 |
| Literature: Kumar; Seth; Bhaduri; Visen; Misra; Gupta; Fatima; Katiyar; Chatterjee; Sen Journal of Medicinal Chemistry, 1984 , vol. 27, # 8 p. 1083 - 1089 |
|
~%
1-N,4-N-bis(4-a... CAS#:89791-40-2 |
| Literature: Kumar; Seth; Bhaduri; Visen; Misra; Gupta; Fatima; Katiyar; Chatterjee; Sen Journal of Medicinal Chemistry, 1984 , vol. 27, # 8 p. 1083 - 1089 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 1-N,4-N-bis(4-amino-3-nitrophenyl)benzene-1,4-dicarboxamide? |
| A: LogP of 1-N,4-N-bis(4-amino-3-nitrophenyl)benzene-1,4-dicarboxamide is 5.52680. |
| Q: What is the molecular weight of 1-N,4-N-bis(4-amino-3-nitrophenyl)benzene-1,4-dicarboxamide? |
| A: Molecular weight of 1-N,4-N-bis(4-amino-3-nitrophenyl)benzene-1,4-dicarboxamide is 436.37800. |
| Q: What is the SMILES notation of 1-N,4-N-bis(4-amino-3-nitrophenyl)benzene-1,4-dicarboxamide? |
| A: SMILES notation of 1-N,4-N-bis(4-amino-3-nitrophenyl)benzene-1,4-dicarboxamide is Nc1ccc(NC(=O)c2ccc(C(=O)Nc3ccc(N)c([N+](=O)[O-])c3)cc2)cc1[N+](=O)[O-]. |
| Q: What is the InChIKey of 1-N,4-N-bis(4-amino-3-nitrophenyl)benzene-1,4-dicarboxamide? |
| A: InChIKey of 1-N,4-N-bis(4-amino-3-nitrophenyl)benzene-1,4-dicarboxamide is YQXFZHAREZIIFG-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-N,4-N-bis(4-amino-3-nitrophenyl)benzene-1,4-dicarboxamide? |
| A: Molecular formula of 1-N,4-N-bis(4-amino-3-nitrophenyl)benzene-1,4-dicarboxamide is C20H16N6O6. |
| Q: What is the CAS number of 1-N,4-N-bis(4-amino-3-nitrophenyl)benzene-1,4-dicarboxamide? |
| A: CAS number of 1-N,4-N-bis(4-amino-3-nitrophenyl)benzene-1,4-dicarboxamide is 89791-40-2. |
| Q: What is the English name of 1-N,4-N-bis(4-amino-3-nitrophenyl)benzene-1,4-dicarboxamide? |
| A: The English name of 1-N,4-N-bis(4-amino-3-nitrophenyl)benzene-1,4-dicarboxamide is 1-N,4-N-bis(4-amino-3-nitrophenyl)benzene-1,4-dicarboxamide. |
| Q: What is the polar surface area (PSA) of 1-N,4-N-bis(4-amino-3-nitrophenyl)benzene-1,4-dicarboxamide? |
| A: Polar surface area (PSA) of 1-N,4-N-bis(4-amino-3-nitrophenyl)benzene-1,4-dicarboxamide is 201.88000. |
| Q: What is the Chinese name of 89791-40-2? |
| A: Chinese name of 89791-40-2 is 89791-40-2. |