2-diphenylphosphorylpropan-1-ol structure
|
Common Name | 2-diphenylphosphorylpropan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 89841-28-1 | Molecular Weight | 260.26800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H17O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-diphenylphosphorylpropan-1-ol |
|---|
| Molecular Formula | C15H17O2P |
|---|---|
| Molecular Weight | 260.26800 |
| Exact Mass | 260.09700 |
| PSA | 47.11000 |
| LogP | 2.38130 |
| InChIKey | HZJOEQWTMCQIHJ-UHFFFAOYSA-N |
| SMILES | CC(CO)P(=O)(c1ccccc1)c1ccccc1 |
|
~81%
2-diphenylphosp... CAS#:89841-28-1 |
| Literature: Imoto, Hiroyuki; Yamashita, Mitsuji Synthesis, 1988 , # 4 p. 323 - 325 |
|
~84%
2-diphenylphosp... CAS#:89841-28-1 |
| Literature: Yamashita, Mitsuji; Yamada, Manabu; Tsunekawa, Kenji; Inokawa, Saburo Bulletin of the Chemical Society of Japan, 1983 , vol. 56, # 11 p. 3533 - 3534 |