1-diphenylphosphorylpropan-1-ol structure
|
Common Name | 1-diphenylphosphorylpropan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 81364-34-3 | Molecular Weight | 260.26800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H17O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-diphenylphosphorylpropan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H17O2P |
|---|---|
| Molecular Weight | 260.26800 |
| Exact Mass | 260.09700 |
| PSA | 47.11000 |
| LogP | 2.72890 |
| InChIKey | JQBOVGNURIKETO-UHFFFAOYSA-N |
| SMILES | CCC(O)P(=O)(c1ccccc1)c1ccccc1 |
|
~%
1-diphenylphosp... CAS#:81364-34-3 |
| Literature: Sekine, Mitsuo; Nakajima, Masashi; Kume, Akiko; Hashizume, Akio; Hata, Tsujiaki Bulletin of the Chemical Society of Japan, 1982 , vol. 55, # 1 p. 224 - 238 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| (1-hydroxypropyl)diphenylphosphine oxide |
| 1-Propanol,1-(diphenylphosphinyl) |