Prostaglandin F2β (tromethamine salt) structure
|
Common Name | Prostaglandin F2β (tromethamine salt) | ||
|---|---|---|---|---|
| CAS Number | 89847-02-9 | Molecular Weight | 475.616 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H45NO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Prostaglandin F2β (tromethamine salt)PGF2β exhibits bronchodilating activity in guinea pigs and cats and antagonizes the bronchoconstrictor activity of PGF2α. |
| Name | Prostaglandin F2β (tromethamine salt) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H45NO8 |
|---|---|
| Molecular Weight | 475.616 |
| Exact Mass | 475.314514 |
| PSA | 184.70000 |
| LogP | 1.40400 |
| InChIKey | IYGXEHDCSOYNKY-ILQMKDCTSA-N |
| SMILES | CCCCCC(O)C=CC1C(O)CC(O)C1CC=CCCCC(=O)O.NC(CO)(CO)CO |
| Prosta-5,13-dien-1-oic acid, 9,11,15-trihydroxy-, (5Z,9β,11α,13E,15S)-, compd. with 2-amino-2-(hydroxymethyl)-1,3-propanediol (1:1) |
| 1,3-Dihydroxy-2-(hydroxymethyl)-2-propanaminium (5Z,9β,11α,13E,15S)-9,11,15-trihydroxyprosta-5,13-dien-1-oate |