1-(4-fluorophenyl)-N-{4-[methyl(phenyl)sulfamoyl]phenyl}-4-oxo-1,4-dihydropyridazine-3-carboxamide structure
|
Common Name | 1-(4-fluorophenyl)-N-{4-[methyl(phenyl)sulfamoyl]phenyl}-4-oxo-1,4-dihydropyridazine-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 898502-75-5 | Molecular Weight | 478.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H19FN4O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-fluorophenyl)-N-{4-[methyl(phenyl)sulfamoyl]phenyl}-4-oxo-1,4-dihydropyridazine-3-carboxamide |
|---|
| Molecular Formula | C24H19FN4O4S |
|---|---|
| Molecular Weight | 478.5 |
| InChIKey | WWWANQCFYVYLGB-UHFFFAOYSA-N |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1ccc(NC(=O)c2nn(-c3ccc(F)cc3)ccc2=O)cc1 |
|
Name: Inhibitors of CDC25B-CDK2/CyclinA interaction
Source: Center for Chemical Genomics, University of Michigan
External Id: MScreen:TargetID_600
|