5-(Methylsulfonyl)-2-nitrobenzoic acid structure
|
Common Name | 5-(Methylsulfonyl)-2-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 898547-72-3 | Molecular Weight | 245.209 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 532.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C8H7NO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.8±30.1 °C | |
| Name | 5-methylsulfonyl-2-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 532.5±50.0 °C at 760 mmHg |
| Molecular Formula | C8H7NO6S |
| Molecular Weight | 245.209 |
| Flash Point | 275.8±30.1 °C |
| Exact Mass | 244.999405 |
| PSA | 125.64000 |
| LogP | 0.35 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.590 |
| InChIKey | FXWQIUPBICXSAU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1ccc([N+](=O)[O-])c(C(=O)O)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2916399090 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid, 5-(methylsulfonyl)-2-nitro- |
| 5-methanesulfonyl-2-nitrobenzoic acid |
| 5-(Methylsulfonyl)-2-nitrobenzoic acid |