(3-tert-butyl-2,2-diphenyloxetan-3-yl)oxy-trimethylsilane structure
|
Common Name | (3-tert-butyl-2,2-diphenyloxetan-3-yl)oxy-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 89867-80-1 | Molecular Weight | 354.55800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H30O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3-tert-butyl-2,2-diphenyloxetan-3-yl)oxy-trimethylsilane |
|---|
| Molecular Formula | C22H30O2Si |
|---|---|
| Molecular Weight | 354.55800 |
| Exact Mass | 354.20200 |
| PSA | 18.46000 |
| LogP | 5.59680 |
| InChIKey | JTUAOGBFXFQAIK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1(O[Si](C)(C)C)COC1(c1ccccc1)c1ccccc1 |
|
~84%
(3-tert-butyl-2... CAS#:89867-80-1 |
| Literature: Shimizu, Nobujiro; Yamaoka, Shintaro; Tsuno, Yuho Bulletin of the Chemical Society of Japan, 1983 , vol. 56, # 12 p. 3853 - 3854 |