[(3,3-Dimethyl-1-buten-2-yl)oxy](trimethyl)silane structure
|
Common Name | [(3,3-Dimethyl-1-buten-2-yl)oxy](trimethyl)silane | ||
|---|---|---|---|---|
| CAS Number | 17510-46-2 | Molecular Weight | 172.340 | |
| Density | 0.8±0.1 g/cm3 | Boiling Point | 142.5±8.0 °C at 760 mmHg | |
| Molecular Formula | C9H20OSi | Melting Point | N/A | |
| MSDS | USA | Flash Point | 24.4±0.0 °C | |
| Symbol |
GHS02, GHS07 |
Signal Word | Warning | |
| Name | 3,3-dimethylbut-1-en-2-yloxy(trimethyl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 142.5±8.0 °C at 760 mmHg |
| Molecular Formula | C9H20OSi |
| Molecular Weight | 172.340 |
| Flash Point | 24.4±0.0 °C |
| Exact Mass | 172.128342 |
| PSA | 9.23000 |
| LogP | 4.00 |
| Vapour Pressure | 7.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.416 |
| InChIKey | PEHJULPJEVIIFJ-UHFFFAOYSA-N |
| SMILES | C=C(O[Si](C)(C)C)C(C)(C)C |
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H226-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 10-36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | UN 1993 3/PG 3 |
| Packaging Group | III |
| Hazard Class | 3.2 |
| HS Code | 2931900090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|
Small-molecule inhibitors of 25-hydroxyvitamin D-24-hydroxylase (CYP24A1): synthesis and biological evaluation.
J. Med. Chem. 57(18) , 7702-15, (2014) The synthesis of imidazole styrylbenzamide, tert-butyl styrylimidazole, and tert-butyl styrylsulfonate derivatives is described. Evaluation of binding affinity and inhibitory activity against CYP24A1 ... |
|
|
Yaws CL.
Thermophysical Properties of Chemicals and Hydrocarbons 2nd ed.,, (2014), 574
|
| [(3,3-Dimethyl-1-buten-2-yl)oxy](trimethyl)silane |
| [(3,3-Dimethylbut-1-en-2-yl)oxy](trimethyl)silane |
| Pinacolone enol trimethylsilyl ether |
| 3,3-Dimethyl-2-trimethylsiloxy-1-butene |
| (2,2-dimethyl-1-methylenepropoxy)trimethylsilane |
| (2,2-dimethyl-1-methylenepropoxy)trimethylsilylane |
| tert-butyl methyl ketone trimethylsilyl enol ether |
| MFCD00075567 |
| methyl tert-butyl ketone trimethylsilyl enol ether |
| pinacolone trimethylsilyl enol ether |
| Me3CC(=CH2)(OSiMe3) |
| ((3,3-dimethylbut-1-en-2-yl)oxy)trimethylsilane |
| PEHJULPJEVIIFJ-UHFFFAOYSA |
| (1-tert-Butylvinyloxy)trimethylsilane |