[(3,3-Dimethyl-1-buten-2-yl)oxy](trimethyl)silane
silane Structure](https://image.chemsrc.com/caspic/006/17510-46-2.png)
[(3,3-Dimethyl-1-buten-2-yl)oxy](trimethyl)silane structure
|
Common Name | [(3,3-Dimethyl-1-buten-2-yl)oxy](trimethyl)silane | ||
|---|---|---|---|---|
| CAS Number | 17510-46-2 | Molecular Weight | 172.340 | |
| Density | 0.8±0.1 g/cm3 | Boiling Point | 142.5±8.0 °C at 760 mmHg | |
| Molecular Formula | C9H20OSi | Melting Point | N/A | |
| MSDS | USA | Flash Point | 24.4±0.0 °C | |
| Symbol |
GHS02, GHS07 |
Signal Word | Warning | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,3-dimethylbut-1-en-2-yloxy(trimethyl)silane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 142.5±8.0 °C at 760 mmHg |
| Molecular Formula | C9H20OSi |
| Molecular Weight | 172.340 |
| Flash Point | 24.4±0.0 °C |
| Exact Mass | 172.128342 |
| PSA | 9.23000 |
| LogP | 4.00 |
| Vapour Pressure | 7.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.416 |
| InChIKey | PEHJULPJEVIIFJ-UHFFFAOYSA-N |
| SMILES | C=C(O[Si](C)(C)C)C(C)(C)C |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H226-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 10-36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | UN 1993 3/PG 3 |
| Packaging Group | III |
| Hazard Class | 3.2 |
| HS Code | 2931900090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 10 | |
CAS#:75-77-4
CAS#:75-97-8
CAS#:630-19-3
CAS#:18107-18-1
CAS#:999-90-6
CAS#:5469-26-1
CAS#:17955-46-3
CAS#:27607-77-8
CAS#:114643-78-6
CAS#:101268-22-8
CAS#:27610-88-4
CAS#:32673-76-0
CAS#:144536-58-3
CAS#:183435-06-5
CAS#:420-56-4
CAS#:84224-37-3
CAS#:84224-47-5This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
This table lists relevant public references with title, journal and publication metadata for this compound.
|
Small-molecule inhibitors of 25-hydroxyvitamin D-24-hydroxylase (CYP24A1): synthesis and biological evaluation.
J. Med. Chem. 57(18) , 7702-15, (2014) The synthesis of imidazole styrylbenzamide, tert-butyl styrylimidazole, and tert-butyl styrylsulfonate derivatives is described. Evaluation of binding affinity and inhibitory activity against CYP24A1 ... |
|
|
Yaws CL.
Thermophysical Properties of Chemicals and Hydrocarbons 2nd ed.,, (2014), 574
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| [(3,3-Dimethyl-1-buten-2-yl)oxy](trimethyl)silane |
| [(3,3-Dimethylbut-1-en-2-yl)oxy](trimethyl)silane |
| Pinacolone enol trimethylsilyl ether |
| 3,3-Dimethyl-2-trimethylsiloxy-1-butene |
| (2,2-dimethyl-1-methylenepropoxy)trimethylsilane |
| (2,2-dimethyl-1-methylenepropoxy)trimethylsilylane |
| tert-butyl methyl ketone trimethylsilyl enol ether |
| MFCD00075567 |
| methyl tert-butyl ketone trimethylsilyl enol ether |
| pinacolone trimethylsilyl enol ether |
| Me3CC(=CH2)(OSiMe3) |
| ((3,3-dimethylbut-1-en-2-yl)oxy)trimethylsilane |
| PEHJULPJEVIIFJ-UHFFFAOYSA |
| (1-tert-Butylvinyloxy)trimethylsilane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 3,3-dimethylbut-1-en-2-yloxy(trimethyl)silane? |
| A: Boiling point of 3,3-dimethylbut-1-en-2-yloxy(trimethyl)silane is 142.5±8.0 °C at 760 mmHg. |
| Q: What is the safety information for 3,3-dimethylbut-1-en-2-yloxy(trimethyl)silane? |
| A: Safety information for 3,3-dimethylbut-1-en-2-yloxy(trimethyl)silane: 26-36. |
| Q: What is the LogP of 3,3-dimethylbut-1-en-2-yloxy(trimethyl)silane? |
| A: LogP of 3,3-dimethylbut-1-en-2-yloxy(trimethyl)silane is 4.00. |
| Q: What is the molecular weight of 3,3-dimethylbut-1-en-2-yloxy(trimethyl)silane? |
| A: Molecular weight of 3,3-dimethylbut-1-en-2-yloxy(trimethyl)silane is 172.340. |
| Q: What is the InChIKey of 3,3-dimethylbut-1-en-2-yloxy(trimethyl)silane? |
| A: InChIKey of 3,3-dimethylbut-1-en-2-yloxy(trimethyl)silane is PEHJULPJEVIIFJ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3,3-dimethylbut-1-en-2-yloxy(trimethyl)silane? |
| A: SMILES notation of 3,3-dimethylbut-1-en-2-yloxy(trimethyl)silane is C=C(O[Si](C)(C)C)C(C)(C)C. |
| Q: What is the polar surface area (PSA) of 3,3-dimethylbut-1-en-2-yloxy(trimethyl)silane? |
| A: Polar surface area (PSA) of 3,3-dimethylbut-1-en-2-yloxy(trimethyl)silane is 9.23000. |
| Q: What is the English name of 3,3-dimethylbut-1-en-2-yloxy(trimethyl)silane? |
| A: The English name of 3,3-dimethylbut-1-en-2-yloxy(trimethyl)silane is 3,3-dimethylbut-1-en-2-yloxy(trimethyl)silane. |
| Q: What is the molecular formula of 3,3-dimethylbut-1-en-2-yloxy(trimethyl)silane? |
| A: Molecular formula of 3,3-dimethylbut-1-en-2-yloxy(trimethyl)silane is C9H20OSi. |
| Q: What are the upstream materials of 3,3-dimethylbut-1-en-2-yloxy(trimethyl)silane? |
| A: Related upstream materials(CAS) of 3,3-dimethylbut-1-en-2-yloxy(trimethyl)silane: 75-77-4;75-97-8;630-19-3;18107-18-1;999-90-6;5469-26-1;17955-46-3;27607-77-8;114643-78-6. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |