Ethyl 8-(2,4-difluorophenyl)-8-oxooctanoate structure
|
Common Name | Ethyl 8-(2,4-difluorophenyl)-8-oxooctanoate | ||
|---|---|---|---|---|
| CAS Number | 898753-12-3 | Molecular Weight | 298.32500 | |
| Density | 1.126g/cm3 | Boiling Point | 375.1ºC at 760 mmHg | |
| Molecular Formula | C16H20F2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.5ºC | |
| Name | Ethyl 8-(2,4-difluorophenyl)-8-oxooctanoate |
|---|
| Density | 1.126g/cm3 |
|---|---|
| Boiling Point | 375.1ºC at 760 mmHg |
| Molecular Formula | C16H20F2O3 |
| Molecular Weight | 298.32500 |
| Flash Point | 174.5ºC |
| Exact Mass | 298.13800 |
| PSA | 43.37000 |
| LogP | 4.05120 |
| Index of Refraction | 1.478 |
| InChIKey | XVOIJGNDUCEXNF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCCCCC(=O)c1ccc(F)cc1F |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |