8-(2,4-Difluorophenyl)-8-oxooctanoic acid structure
|
Common Name | 8-(2,4-Difluorophenyl)-8-oxooctanoic acid | ||
|---|---|---|---|---|
| CAS Number | 898766-31-9 | Molecular Weight | 270.27200 | |
| Density | 1.211g/cm3 | Boiling Point | 413.6ºC at 760 mmHg | |
| Molecular Formula | C14H16F2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.9ºC | |
| Name | 8-(2,4-Difluorophenyl)-8-oxooctanoic acid |
|---|
| Density | 1.211g/cm3 |
|---|---|
| Boiling Point | 413.6ºC at 760 mmHg |
| Molecular Formula | C14H16F2O3 |
| Molecular Weight | 270.27200 |
| Flash Point | 203.9ºC |
| Exact Mass | 270.10700 |
| PSA | 54.37000 |
| LogP | 3.57270 |
| Index of Refraction | 1.5 |
| InChIKey | XBNOQBIPRMRFKH-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCCCC(=O)c1ccc(F)cc1F |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |