ethyl 8-(2,6-dimethoxyphenyl)-8-oxooctanoate
Modify Date: 2024-02-25 16:11:32
ethyl 8-(2,6-dimethoxyphenyl)-8-oxooctanoate structure
|
Common Name | ethyl 8-(2,6-dimethoxyphenyl)-8-oxooctanoate | ||
|---|---|---|---|---|
| CAS Number | 898758-53-7 | Molecular Weight | 322.39600 | |
| Density | 1.058g/cm3 | Boiling Point | 435.9ºC at 760 mmHg | |
| Molecular Formula | C18H26O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.4ºC | |
| Name | ethyl 8-(2,6-dimethoxyphenyl)-8-oxooctanoate |
|---|
| Density | 1.058g/cm3 |
|---|---|
| Boiling Point | 435.9ºC at 760 mmHg |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.39600 |
| Flash Point | 214.4ºC |
| Exact Mass | 322.17800 |
| PSA | 61.83000 |
| LogP | 3.79020 |
| Index of Refraction | 1.492 |
| InChIKey | YSFIEJZHTQCFCB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCCCCCC(=O)c1c(OC)cccc1OC |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |