6-CHLORO-1-(4-NITROPHENYL)-1-OXOHEXANE structure
|
Common Name | 6-CHLORO-1-(4-NITROPHENYL)-1-OXOHEXANE | ||
|---|---|---|---|---|
| CAS Number | 898768-41-7 | Molecular Weight | 255.69700 | |
| Density | 1.216g/cm3 | Boiling Point | 392.6ºC at 760 mmHg | |
| Molecular Formula | C12H14ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.2ºC | |
| Name | 6-chloro-1-(4-nitrophenyl)hexan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.216g/cm3 |
|---|---|
| Boiling Point | 392.6ºC at 760 mmHg |
| Molecular Formula | C12H14ClNO3 |
| Molecular Weight | 255.69700 |
| Flash Point | 191.2ºC |
| Exact Mass | 255.06600 |
| PSA | 62.89000 |
| LogP | 4.09990 |
| Index of Refraction | 1.542 |
| InChIKey | RUSLWASPLNLWGL-UHFFFAOYSA-N |
| SMILES | O=C(CCCCCCl)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 6-chloro-1-(4-nitrophenyl)-1-oxohexane |