3,4-DIMETHYL-3'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE structure
|
Common Name | 3,4-DIMETHYL-3'-(1,3-DIOXOLAN-2-YL)BENZOPHENONE | ||
|---|---|---|---|---|
| CAS Number | 898779-42-5 | Molecular Weight | 282.33400 | |
| Density | 1.149g/cm3 | Boiling Point | 466.4ºC at 760 mmHg | |
| Molecular Formula | C18H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.9ºC | |
| Name | (3,4-dimethylphenyl)-[3-(1,3-dioxolan-2-yl)phenyl]methanone |
|---|
| Density | 1.149g/cm3 |
|---|---|
| Boiling Point | 466.4ºC at 760 mmHg |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.33400 |
| Flash Point | 227.9ºC |
| Exact Mass | 282.12600 |
| PSA | 35.53000 |
| LogP | 3.57980 |
| Index of Refraction | 1.572 |
| InChIKey | IVCASLJSDKVYDY-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)c2cccc(C3OCCO3)c2)cc1C |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |