1(2H)-Phthalazinone,7-nitro- structure
|
Common Name | 1(2H)-Phthalazinone,7-nitro- | ||
|---|---|---|---|---|
| CAS Number | 89898-94-2 | Molecular Weight | 191.14400 | |
| Density | 1.64g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H5N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-nitro-2H-phthalazin-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.64g/cm3 |
|---|---|
| Molecular Formula | C8H5N3O3 |
| Molecular Weight | 191.14400 |
| Exact Mass | 191.03300 |
| PSA | 91.57000 |
| LogP | 1.35450 |
| Index of Refraction | 1.739 |
| InChIKey | OOKJRZYVWWMGFI-UHFFFAOYSA-N |
| SMILES | O=c1[nH]ncc2ccc([N+](=O)[O-])cc12 |
|
~%
1(2H)-Phthalazi... CAS#:89898-94-2 |
| Literature: Atkinson et al. Journal of the Chemical Society, 1956 , p. 1081 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1(2H)-Phthalazinone,7-nitro |
| 7-nitrophthalazin-1(2H)-one |
| 1,2-Dihydro-7-nitro-1-oxophthalazin |
| 7-Nitro-2H-phthalazin-1-on |
| 1,2-dihydro-7-nitro-1-oxophthalazine |
| 7-nitro-1(2H)-phthalazinone |