Benzoic acid,2-formyl-5-nitro structure
|
Common Name | Benzoic acid,2-formyl-5-nitro | ||
|---|---|---|---|---|
| CAS Number | 7464-91-7 | Molecular Weight | 195.12900 | |
| Density | 1.555g/cm3 | Boiling Point | 424.8ºC at 760mmHg | |
| Molecular Formula | C8H5NO5 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 193.3ºC | |
| Name | 2-formyl-5-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.555g/cm3 |
|---|---|
| Boiling Point | 424.8ºC at 760mmHg |
| Molecular Formula | C8H5NO5 |
| Molecular Weight | 195.12900 |
| Flash Point | 193.3ºC |
| Exact Mass | 195.01700 |
| PSA | 100.19000 |
| LogP | 1.62870 |
| Index of Refraction | 1.662 |
| InChIKey | IQZDAZHSOLMQJD-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc([N+](=O)[O-])cc1C(=O)O |
| HS Code | 2918300090 |
|---|
|
~%
Benzoic acid,2-... CAS#:7464-91-7 |
| Literature: Du Pont de Nemours and Co. Patent: US2047946 , 1934 ; |
|
~%
Benzoic acid,2-... CAS#:7464-91-7 |
| Literature: Abaev, Vladimir T.; Dmitriev, Artem S.; Gutnov, Andrey V.; Podelyakin, Sergey A.; Butin, Alexander V. Journal of Heterocyclic Chemistry, 2006 , vol. 43, # 5 p. 1195 - 1204 |
|
~%
Benzoic acid,2-... CAS#:7464-91-7 |
| Literature: Abaev, Vladimir T.; Dmitriev, Artem S.; Gutnov, Andrey V.; Podelyakin, Sergey A.; Butin, Alexander V. Journal of Heterocyclic Chemistry, 2006 , vol. 43, # 5 p. 1195 - 1204 |
|
~%
Benzoic acid,2-... CAS#:7464-91-7 |
| Literature: Bakunin; Kossinova Gazzetta Chimica Italiana, 1915 , vol. 45 I, p. 164 |
|
~%
Benzoic acid,2-... CAS#:7464-91-7 |
| Literature: Wegscheider; Kusy v. Dubrav Monatshefte fuer Chemie, 1903 , vol. 24, p. 828 |
|
~%
Benzoic acid,2-... CAS#:7464-91-7 |
| Literature: Wegscheider; Kusy v. Dubrav Monatshefte fuer Chemie, 1903 , vol. 24, p. 828 |
|
~%
Benzoic acid,2-... CAS#:7464-91-7 |
| Literature: Bakunin; Kossinova Gazzetta Chimica Italiana, 1915 , vol. 45 I, p. 164 |
| Precursor 5 | |
|---|---|
| DownStream 4 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 5-Nitrophthalaldehydic acid |
| Benzoic acid,2-formyl-5-nitro |
| 2-Formyl-5-nitro-benzoesaeure |
| 2-Formyl-5-nitro-benzoic acid |
| 4-nitrosalicylaldehyde |
| 2-carboxy-4-nitrobenzaldehyde |
| 5-Nitro-phthalaldehydsaeure |
| 5-Nitro-2-formyl-benzoesaeure |