1,1,1-trifluoro-N-phenyl-N-trimethylsilylmethanesulfonamide
1,1,1-trifluoro-N-phenyl-N-trimethylsilylmethanesulfonamide structure
|
Common Name | 1,1,1-trifluoro-N-phenyl-N-trimethylsilylmethanesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 89902-40-9 | Molecular Weight | 297.36900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14F3NO2SSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1,1-trifluoro-N-phenyl-N-trimethylsilylmethanesulfonamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H14F3NO2SSi |
|---|---|
| Molecular Weight | 297.36900 |
| Exact Mass | 297.04700 |
| PSA | 45.76000 |
| LogP | 4.25830 |
| InChIKey | YAIUBQLOQVPCLV-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)N(c1ccccc1)S(=O)(=O)C(F)(F)F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1,1,1-trifluoro... CAS#:89902-40-9 |
| Literature: Iley, Jim; Bassindale, Alan R.; Patel, Pravin Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1984 , # 1 p. 77 - 80 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 1,1,1-trifluoro-N-phenyl-N-trimethylsilylmethanesulfonamide? |
| A: Polar surface area (PSA) of 1,1,1-trifluoro-N-phenyl-N-trimethylsilylmethanesulfonamide is 45.76000. |
| Q: What is the SMILES notation of 1,1,1-trifluoro-N-phenyl-N-trimethylsilylmethanesulfonamide? |
| A: SMILES notation of 1,1,1-trifluoro-N-phenyl-N-trimethylsilylmethanesulfonamide is C[Si](C)(C)N(c1ccccc1)S(=O)(=O)C(F)(F)F. |
| Q: What is the molecular formula of 1,1,1-trifluoro-N-phenyl-N-trimethylsilylmethanesulfonamide? |
| A: Molecular formula of 1,1,1-trifluoro-N-phenyl-N-trimethylsilylmethanesulfonamide is C10H14F3NO2SSi. |
| Q: What is the Chinese name of 89902-40-9? |
| A: Chinese name of 89902-40-9 is 89902-40-9. |
| Q: What is the English name of 1,1,1-trifluoro-N-phenyl-N-trimethylsilylmethanesulfonamide? |
| A: The English name of 1,1,1-trifluoro-N-phenyl-N-trimethylsilylmethanesulfonamide is 1,1,1-trifluoro-N-phenyl-N-trimethylsilylmethanesulfonamide. |
| Q: What is the molecular weight of 1,1,1-trifluoro-N-phenyl-N-trimethylsilylmethanesulfonamide? |
| A: Molecular weight of 1,1,1-trifluoro-N-phenyl-N-trimethylsilylmethanesulfonamide is 297.36900. |
| Q: What is the LogP of 1,1,1-trifluoro-N-phenyl-N-trimethylsilylmethanesulfonamide? |
| A: LogP of 1,1,1-trifluoro-N-phenyl-N-trimethylsilylmethanesulfonamide is 4.25830. |
| Q: What is the CAS number of 1,1,1-trifluoro-N-phenyl-N-trimethylsilylmethanesulfonamide? |
| A: CAS number of 1,1,1-trifluoro-N-phenyl-N-trimethylsilylmethanesulfonamide is 89902-40-9. |
| Q: What is the InChIKey of 1,1,1-trifluoro-N-phenyl-N-trimethylsilylmethanesulfonamide? |
| A: InChIKey of 1,1,1-trifluoro-N-phenyl-N-trimethylsilylmethanesulfonamide is YAIUBQLOQVPCLV-UHFFFAOYSA-N. |