AC-ASP-TYR(SO3H)-MET-GLY-TRP-MET-NH2 structure
|
Common Name | AC-ASP-TYR(SO3H)-MET-GLY-TRP-MET-NH2 | ||
|---|---|---|---|---|
| CAS Number | 89911-65-9 | Molecular Weight | 923.04400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C38H50N8O13S3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
Use of AC-ASP-TYR(SO3H)-MET-GLY-TRP-MET-NH2CCK (26-31) (sulfated) is the N-terminal fragment of CCK, a peptide hormone found in the gut and brain that stimulates digestion, regulates satiety, and is associated with anxiety[1]. |
| Name | 3-acetamido-4-[[1-[[1-[[2-[[1-[(1-amino-4-methylsulfanyl-1-oxobutan-2-yl)amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-2-oxoethyl]amino]-4-methylsulfanyl-1-oxobutan-2-yl]amino]-1-oxo-3-(4-sulfooxyphenyl)propan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | CCK (26-31) (sulfated) is the N-terminal fragment of CCK, a peptide hormone found in the gut and brain that stimulates digestion, regulates satiety, and is associated with anxiety[1]. |
|---|---|
| Related Catalog |
| Molecular Formula | C38H50N8O13S3 |
|---|---|
| Molecular Weight | 923.04400 |
| Exact Mass | 922.26600 |
| PSA | 393.36000 |
| LogP | 3.28750 |
| InChIKey | CAZXCDOBKJYAJQ-UHFFFAOYSA-N |
| SMILES | CSCCC(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)CNC(=O)C(CCSC)NC(=O)C(Cc1ccc(OS(=O)(=O)O)cc1)NC(=O)C(CC(=O)O)NC(C)=O)C(N)=O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Acetyl-[Tyr(SO3H)27]-Cholecystokinin fragment 26-31 Amide |
| AC-ASP-TYR(SO3H)-MET-GLY-TRP-MET-NH2 |