3-(4-methylphenyl)pyrrole-2,5-dione structure
|
Common Name | 3-(4-methylphenyl)pyrrole-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 89931-79-3 | Molecular Weight | 187.19500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(4-methylphenyl)pyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H9NO2 |
|---|---|
| Molecular Weight | 187.19500 |
| Exact Mass | 187.06300 |
| PSA | 49.66000 |
| LogP | 1.31070 |
| InChIKey | UJNLRBKIVGGVIP-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C2=CC(=O)NC2=O)cc1 |
|
~%
3-(4-methylphen... CAS#:89931-79-3 |
| Literature: Rondestvedt; Vogl Journal of the American Chemical Society, 1955 , vol. 77, p. 2313 |
| 3-p-tolyl-pyrrole-2,5-dione |
| 3-p-Tolyl-pyrrol-2,5-dion |