Hedysarimcoumestane B structure
|
Common Name | Hedysarimcoumestane B | ||
|---|---|---|---|---|
| CAS Number | 899436-04-5 | Molecular Weight | 298.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H10O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Hedysarimcoumestane BHedysarimcoumestan B is a natural product that can be isolated from the roots of Hedysarum multijugum[1]. |
| Name | 6H-Benzofuro[3,2-c][1]benzopyran-6-one, 1,3-dihydroxy-9-methoxy- |
|---|---|
| Synonym | More Synonyms |
| Description | Hedysarimcoumestan B is a natural product that can be isolated from the roots of Hedysarum multijugum[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Wang W, et al. Coumestans from Hedysarum multijugum. J Nat Prod. 2006 Jun;69(6):876-80. |
| Molecular Formula | C16H10O6 |
|---|---|
| Molecular Weight | 298.25 |
| InChIKey | AAKHRTZXSZBLFQ-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)oc1c3c(O)cc(O)cc3oc(=O)c21 |
| Storage condition | 2-8°C |
| Hedysarimcoumestane B |