5-(3-Nitrophenyl)-1H-pyrazole-3-carboxylic acid
Modify Date: 2025-09-24 16:39:54
5-(3-Nitrophenyl)-1H-pyrazole-3-carboxylic acid structure
|
Common Name | 5-(3-Nitrophenyl)-1H-pyrazole-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 899714-76-2 | Molecular Weight | 233.18000 | |
| Density | 1.547g/cm3 | Boiling Point | 579ºC at 760 mmHg | |
| Molecular Formula | C10H7N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 304ºC | |
| Name | 5-(3-Nitrophenyl)-1H-pyrazole-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.547g/cm3 |
|---|---|
| Boiling Point | 579ºC at 760 mmHg |
| Molecular Formula | C10H7N3O4 |
| Molecular Weight | 233.18000 |
| Flash Point | 304ºC |
| Exact Mass | 233.04400 |
| PSA | 111.80000 |
| LogP | 2.20630 |
| Index of Refraction | 1.678 |
| InChIKey | KOYVJIGBLQRTRF-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(-c2cccc([N+](=O)[O-])c2)n[nH]1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933199090 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(3-nitrophenyl)-1H-pyrazole-5-carboxylic acid |