N-(3-chlorophenyl)-N-(furan-2-carbonyl)piperidine-1-carboxamide
Modify Date: 2026-07-31 19:26:12
N-(3-chlorophenyl)-N-(furan-2-carbonyl)piperidine-1-carboxamide structure
|
Common Name | N-(3-chlorophenyl)-N-(furan-2-carbonyl)piperidine-1-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 899755-65-8 | Molecular Weight | 332.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H17ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(3-chlorophenyl)-N-(furan-2-carbonyl)piperidine-1-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H17ClN2O3 |
|---|---|
| Molecular Weight | 332.8 |
| InChIKey | XWVGBBIAIRBKNS-UHFFFAOYSA-N |
| SMILES | O=C(c1ccco1)N(C(=O)N1CCCCC1)c1cccc(Cl)c1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_HPP
|
Total 3, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N-(3-chlorophenyl)-N-(furan-2-carbonyl)piperidine-1-carboxamide? |
| A: The English name of N-(3-chlorophenyl)-N-(furan-2-carbonyl)piperidine-1-carboxamide is N-(3-chlorophenyl)-N-(furan-2-carbonyl)piperidine-1-carboxamide. |
| Q: What is the InChIKey of N-(3-chlorophenyl)-N-(furan-2-carbonyl)piperidine-1-carboxamide? |
| A: InChIKey of N-(3-chlorophenyl)-N-(furan-2-carbonyl)piperidine-1-carboxamide is XWVGBBIAIRBKNS-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N-(3-chlorophenyl)-N-(furan-2-carbonyl)piperidine-1-carboxamide? |
| A: Molecular formula of N-(3-chlorophenyl)-N-(furan-2-carbonyl)piperidine-1-carboxamide is C17H17ClN2O3. |
| Q: What is the Chinese name of 899755-65-8? |
| A: Chinese name of 899755-65-8 is 899755-65-8. |
| Q: What is the molecular weight of N-(3-chlorophenyl)-N-(furan-2-carbonyl)piperidine-1-carboxamide? |
| A: Molecular weight of N-(3-chlorophenyl)-N-(furan-2-carbonyl)piperidine-1-carboxamide is 332.8. |
| Q: What is the SMILES notation of N-(3-chlorophenyl)-N-(furan-2-carbonyl)piperidine-1-carboxamide? |
| A: SMILES notation of N-(3-chlorophenyl)-N-(furan-2-carbonyl)piperidine-1-carboxamide is O=C(c1ccco1)N(C(=O)N1CCCCC1)c1cccc(Cl)c1. |
| Q: What is the CAS number of N-(3-chlorophenyl)-N-(furan-2-carbonyl)piperidine-1-carboxamide? |
| A: CAS number of N-(3-chlorophenyl)-N-(furan-2-carbonyl)piperidine-1-carboxamide is 899755-65-8. |