3,4-Dimethoxyphenylmagnesium bromide structure
|
Common Name | 3,4-Dimethoxyphenylmagnesium bromide | ||
|---|---|---|---|---|
| CAS Number | 89980-69-8 | Molecular Weight | 241.36500 | |
| Density | 0.960 g/mL at 25ºC | Boiling Point | 65ºC | |
| Molecular Formula | C8H9BrMgO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 1 °F | |
| Name | 3,4-Dimethoxyphenylmagnesium bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.960 g/mL at 25ºC |
|---|---|
| Boiling Point | 65ºC |
| Molecular Formula | C8H9BrMgO2 |
| Molecular Weight | 241.36500 |
| Flash Point | 1 °F |
| Exact Mass | 239.96400 |
| PSA | 18.46000 |
| LogP | 2.34960 |
| InChIKey | QUXWTJDOUGUTNI-UHFFFAOYSA-M |
| SMILES | COc1c[c-]ccc1OC.[Br-].[Mg+2] |
| Storage condition | 2-8°C |
| Water Solubility | Reacts with water. |
| Hazard Codes | F: Flammable;C: Corrosive; |
|---|---|
| Risk Phrases | R11 |
| Safety Phrases | 16-26-36/37/39-45 |
| RIDADR | UN 2924 3/PG 2 |
| WGK Germany | 1 |
| HS Code | 2931900090 |
|
~%
3,4-Dimethoxyph... CAS#:89980-69-8 |
| Literature: WO2005/75456 A1, ; Page/Page column 26 ; WO 2005/075456 A1 |
|
~%
3,4-Dimethoxyph... CAS#:89980-69-8 |
| Literature: WO2005/75437 A1, ; Page/Page column 35 ; WO 2005/075437 A1 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| MFCD01311476 |
| magnesium,1,2-dimethoxybenzene-5-ide,bromide |