Valethamate Bromide structure
|
Common Name | Valethamate Bromide | ||
|---|---|---|---|---|
| CAS Number | 90-22-2 | Molecular Weight | 386.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H32BrNO2 | Melting Point | 127 °C(dec.) | |
| MSDS | N/A | Flash Point | N/A | |
Use of Valethamate BromideValethamate bromide is an ester and is a potent rapidly acting anticholinergic spasmolytic and musculotropic agent which accelerates labor by improving cervical dilation[1]. |
| Name | Valethamate Bromide |
|---|---|
| Synonym | More Synonyms |
| Description | Valethamate bromide is an ester and is a potent rapidly acting anticholinergic spasmolytic and musculotropic agent which accelerates labor by improving cervical dilation[1]. |
|---|---|
| Related Catalog | |
| References |
| Melting Point | 127 °C(dec.) |
|---|---|
| Molecular Formula | C19H32BrNO2 |
| Molecular Weight | 386.37 |
| Exact Mass | 385.161621 |
| PSA | 26.30000 |
| LogP | 0.84990 |
| InChIKey | CEJGGHKJHDHLAZ-UHFFFAOYSA-M |
| SMILES | CCC(C)C(C(=O)OCC[N+](C)(CC)CC)c1ccccc1.[Br-] |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | 24/25 |
| RIDADR | UN 2811 |
| HS Code | 2923900090 |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Name: DRUGMATRIX: Opiate delta1 (OP1, DOP) radioligand binding (ligand: [3H] Naltrindole)
Source: ChEMBL
Target: Delta-type opioid receptor
External Id: CHEMBL1909180
|
|
Name: DRUGMATRIX: Nitric Oxide Synthase, Inducible (iNOS) enzyme inhibition (substrate: L-A...
Source: ChEMBL
Target: Nitric oxide synthase, inducible
External Id: CHEMBL1909179
|
|
Name: DRUGMATRIX: Opiate mu (OP3, MOP) radioligand binding (ligand: [3H] Diprenorphine)
Source: ChEMBL
Target: Mu-type opioid receptor
External Id: CHEMBL1909182
|
|
Name: DRUGMATRIX: Opiate kappa (OP2, KOP) radioligand binding (ligand: [3H] Diprenorphine)
Source: ChEMBL
Target: Kappa-type opioid receptor
External Id: CHEMBL1909181
|
|
Name: DRUGMATRIX: Phosphodiesterase PDE3 enzyme inhibition (substrate: [3H]cAMP + cAMP)
Source: ChEMBL
Target: N/A
External Id: CHEMBL1909184
|
|
Name: DRUGMATRIX: Phorbol Ester radioligand binding (ligand: [3H] PDBu)
Source: ChEMBL
Target: N/A
External Id: CHEMBL1909183
|
|
Name: DRUGMATRIX: Phosphodiesterase PDE5 enzyme inhibition (substrate: [3H]cGMP + cGMP)
Source: ChEMBL
Target: cGMP-specific 3',5'-cyclic phosphodiesterase
External Id: CHEMBL1909186
|
|
Name: DRUGMATRIX: Phosphodiesterase PDE4 enzyme inhibition (substrate: [3H]cAMP + cAMP)
Source: ChEMBL
Target: N/A
External Id: CHEMBL1909185
|
|
Name: DRUGMATRIX: Muscarinic M3 radioligand binding (ligand: [3H] N-Methylscopolamine)
Source: ChEMBL
Target: Muscarinic acetylcholine receptor M3
External Id: CHEMBL1909172
|
|
Name: DRUGMATRIX: Muscarinic M2 radioligand binding (ligand: [3H] N-Methylscopolamine)
Source: ChEMBL
Target: Muscarinic acetylcholine receptor M2
External Id: CHEMBL1909171
|
| Epidosin |
| EINECS 201-977-8 |
| diethyl-methyl-[2-(3-methyl-2-phenylpentanoyl)oxyethyl]azanium,bromide |
| Resitan |
| MFCD00031617 |
| N,N-Diethyl-N-methyl-2-[(3-methyl-1-oxo-2-phenylpentyl)oxy]ethanaminium bromide |
| Valethamate Bromide |
| 2-Phenyl-3-methylvaleric Acid b-(Diethylamino)ethyl Ester Bromomethylate |
| Ethanaminium, N,N-diethyl-N-methyl-2-[(3-methyl-1-oxo-2-phenylpentyl)oxy]-, bromide |
| N,N-Diethyl-N-methyl-2-[(3-methyl-2-phenylpentanoyl)oxy]ethanaminium bromide |
| Ethanaminium, N,N-diethyl-N-methyl-2-[(3-methyl-1-oxo-2-phenylpentyl)oxy]-, bromide (1:1) |