1-(3-Chlorophenyl)-3-methyl-2-pyrazolin-5-one
Modify Date: 2025-08-25 18:33:05
1-(3-Chlorophenyl)-3-methyl-2-pyrazolin-5-one structure
|
Common Name | 1-(3-Chlorophenyl)-3-methyl-2-pyrazolin-5-one | ||
|---|---|---|---|---|
| CAS Number | 90-31-3 | Molecular Weight | 208.64400 | |
| Density | 1.32g/cm3 | Boiling Point | 382.9ºC at 760 mmHg | |
| Molecular Formula | C10H9ClN2O | Melting Point | 128-131ºC | |
| MSDS | Chinese USA | Flash Point | 185.4ºC | |
| Name | 2-(3-chlorophenyl)-5-methyl-4H-pyrazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 382.9ºC at 760 mmHg |
| Melting Point | 128-131ºC |
| Molecular Formula | C10H9ClN2O |
| Molecular Weight | 208.64400 |
| Flash Point | 185.4ºC |
| Exact Mass | 208.04000 |
| PSA | 32.67000 |
| LogP | 1.95320 |
| Index of Refraction | 1.625 |
| InChIKey | RIOMUJXIGYZENC-UHFFFAOYSA-N |
| SMILES | CC1=NN(c2cccc(Cl)c2)C(=O)C1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933199090 |
|
~%
1-(3-Chlorophen... CAS#:90-31-3 |
| Literature: Tetrahedron Letters, , vol. 53, # 49 p. 6650 - 6653 |
|
~%
1-(3-Chlorophen... CAS#:90-31-3 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 49, # 5 p. 1169 - 1178 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| chloropyrazolone |
| EINECS 201-984-6 |
| m-chloropyrazolone |
| MFCD00020750 |