1,3,5-trichloro-2,4,6-tris(dimethoxyphosphoryloxy)benzene structure
|
Common Name | 1,3,5-trichloro-2,4,6-tris(dimethoxyphosphoryloxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 90010-09-6 | Molecular Weight | 553.54400 | |
| Density | 1.548g/cm3 | Boiling Point | 503.2ºC at 760 mmHg | |
| Molecular Formula | C12H18Cl3O12P3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 437ºC | |
| Name | dimethyl [2,4,6-trichloro-3,5-bis(dimethoxyphosphoryloxy)phenyl] phosphate |
|---|
| Density | 1.548g/cm3 |
|---|---|
| Boiling Point | 503.2ºC at 760 mmHg |
| Molecular Formula | C12H18Cl3O12P3 |
| Molecular Weight | 553.54400 |
| Flash Point | 437ºC |
| Exact Mass | 551.90800 |
| PSA | 163.71000 |
| LogP | 5.98590 |
| Index of Refraction | 1.504 |
| InChIKey | VVHIOMHVSNYTKO-UHFFFAOYSA-N |
| SMILES | COP(=O)(OC)Oc1c(Cl)c(OP(=O)(OC)OC)c(Cl)c(OP(=O)(OC)OC)c1Cl |
|
~%
1,3,5-trichloro... CAS#:90010-09-6 |
| Literature: Wiley,D.W.; Simmons,H.E. Journal of Organic Chemistry, 1964 , vol. 29, p. 1876 - 1879 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |