estrone acetate structure
|
Common Name | estrone acetate | ||
|---|---|---|---|---|
| CAS Number | 901-93-9 | Molecular Weight | 312.40300 | |
| Density | 1.151g/cm3 | Boiling Point | 454.2ºC at 760mmHg | |
| Molecular Formula | C20H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.4ºC | |
| Name | estrone acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.151g/cm3 |
|---|---|
| Boiling Point | 454.2ºC at 760mmHg |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.40300 |
| Flash Point | 199.4ºC |
| Exact Mass | 312.17300 |
| PSA | 43.37000 |
| LogP | 4.03710 |
| Index of Refraction | 1.558 |
| InChIKey | KDPQTPZDVJHMET-XSYGEPLQSA-N |
| SMILES | CC(=O)Oc1ccc2c(c1)CCC1C2CCC2(C)C(=O)CCC12 |
|
Name: Inhibition of purified human steroid sulfatase
Source: ChEMBL
Target: Steryl-sulfatase
External Id: CHEMBL829433
|
|
Name: Human Phosphogluconate dehydrogenase (6PGD) Inhibitor Screening
Source: 11827
Target: Phosphogluconate dehydrogenase
External Id: 6PGD_Inhibitor_Screening_2015_09
|
| oestrone Acetate |
| 3-ACETOXYESTRONE |
| acetoxyestrone |
| 3-Hydroxyestra-1,3,5(10)-17-one acetate |
| Hogival |
| 3-O-acetyl-estrone |
| Oestrone-3-acetate |
| Estrone 3-acetate |
| 3-Acetoxy-17-oxo-estra-1,3,5(10)-triene |
| 3-acetoxy-1,3,5(10)-estratrien-17-one |
| puboestrene |
| 3-Acetoxyestrone R |