methyl 2-(diacetylamino)-3-methoxyprop-2-enoate
methyl 2-(diacetylamino)-3-methoxyprop-2-enoate structure
|
Common Name | methyl 2-(diacetylamino)-3-methoxyprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 90237-83-5 | Molecular Weight | 215.20300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 2-(diacetylamino)-3-methoxyprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H13NO5 |
|---|---|
| Molecular Weight | 215.20300 |
| Exact Mass | 215.07900 |
| PSA | 72.91000 |
| LogP | 0.04220 |
| InChIKey | YHYNNPJHBOTPEH-UHFFFAOYSA-N |
| SMILES | COC=C(C(=O)OC)N(C(C)=O)C(C)=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~73%
methyl 2-(diace... CAS#:90237-83-5 |
| Literature: Effenberger, Franz; Beisswenger, Thomas Chemische Berichte, 1984 , vol. 117, # 4 p. 1497 - 1512 |
|
~%
methyl 2-(diace... CAS#:90237-83-5 |
| Literature: Effenberger, Franz; Beisswenger, Thomas Chemische Berichte, 1984 , vol. 117, # 4 p. 1497 - 1512 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-Propenoic acid,2-(diacetylamino)-3-methoxy-,methyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does methyl 2-(diacetylamino)-3-methoxyprop-2-enoate have? |
| A: English synonyms of methyl 2-(diacetylamino)-3-methoxyprop-2-enoate: 2-Propenoic acid,2-(diacetylamino)-3-methoxy-,methyl ester. |
| Q: What is the LogP of methyl 2-(diacetylamino)-3-methoxyprop-2-enoate? |
| A: LogP of methyl 2-(diacetylamino)-3-methoxyprop-2-enoate is 0.04220. |
| Q: What is the English name of methyl 2-(diacetylamino)-3-methoxyprop-2-enoate? |
| A: The English name of methyl 2-(diacetylamino)-3-methoxyprop-2-enoate is methyl 2-(diacetylamino)-3-methoxyprop-2-enoate. |
| Q: What is the molecular weight of methyl 2-(diacetylamino)-3-methoxyprop-2-enoate? |
| A: Molecular weight of methyl 2-(diacetylamino)-3-methoxyprop-2-enoate is 215.20300. |
| Q: What is the SMILES notation of methyl 2-(diacetylamino)-3-methoxyprop-2-enoate? |
| A: SMILES notation of methyl 2-(diacetylamino)-3-methoxyprop-2-enoate is COC=C(C(=O)OC)N(C(C)=O)C(C)=O. |
| Q: What is the InChIKey of methyl 2-(diacetylamino)-3-methoxyprop-2-enoate? |
| A: InChIKey of methyl 2-(diacetylamino)-3-methoxyprop-2-enoate is YHYNNPJHBOTPEH-UHFFFAOYSA-N. |
| Q: What is the CAS number of methyl 2-(diacetylamino)-3-methoxyprop-2-enoate? |
| A: CAS number of methyl 2-(diacetylamino)-3-methoxyprop-2-enoate is 90237-83-5. |
| Q: What is the Chinese name of 90237-83-5? |
| A: Chinese name of 90237-83-5 is 90237-83-5. |
| Q: What is the polar surface area (PSA) of methyl 2-(diacetylamino)-3-methoxyprop-2-enoate? |
| A: Polar surface area (PSA) of methyl 2-(diacetylamino)-3-methoxyprop-2-enoate is 72.91000. |
| Q: What is the molecular formula of methyl 2-(diacetylamino)-3-methoxyprop-2-enoate? |
| A: Molecular formula of methyl 2-(diacetylamino)-3-methoxyprop-2-enoate is C9H13NO5. |