8-bromo-2-chloro-quinoline-4-carboxylic acid structure
|
Common Name | 8-bromo-2-chloro-quinoline-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 902743-27-5 | Molecular Weight | 286.50900 | |
| Density | 1.82g/cm3 | Boiling Point | 420.98ºC at 760 mmHg | |
| Molecular Formula | C10H5BrClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.402ºC | |
| Name | 8-Bromo-2-chloroquinoline-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.82g/cm3 |
|---|---|
| Boiling Point | 420.98ºC at 760 mmHg |
| Molecular Formula | C10H5BrClNO2 |
| Molecular Weight | 286.50900 |
| Flash Point | 208.402ºC |
| Exact Mass | 284.91900 |
| PSA | 50.19000 |
| LogP | 3.34890 |
| Index of Refraction | 1.713 |
| InChIKey | LAMSTKBOIPGCCC-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(Cl)nc2c(Br)cccc12 |
| Storage condition | 2-8°C |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD06810605 |