1-(3-Methylbutanoyl)piperidin-4-amine structure
|
Common Name | 1-(3-Methylbutanoyl)piperidin-4-amine | ||
|---|---|---|---|---|
| CAS Number | 902836-42-4 | Molecular Weight | 261.75000 | |
| Density | 0.99g/cm3 | Boiling Point | 311.214ºC at 760 mmHg | |
| Molecular Formula | C14H16ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.018ºC | |
| Name | 4-[4-(2-chlorophenyl)pyrazol-1-yl]piperidine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.99g/cm3 |
|---|---|
| Boiling Point | 311.214ºC at 760 mmHg |
| Molecular Formula | C14H16ClN3 |
| Molecular Weight | 261.75000 |
| Flash Point | 142.018ºC |
| Exact Mass | 261.10300 |
| PSA | 29.85000 |
| LogP | 3.45680 |
| Index of Refraction | 1.484 |
| InChIKey | RRRIXLCXVVGUTG-UHFFFAOYSA-N |
| SMILES | Clc1ccccc1-c1cnn(C2CCNCC2)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-[4-(2-Chlorophenyl)-1H-Pyrazol-1-Yl]Piperidine |
| 4-(2-chlorophenyl)-1-(4-piperidyl)pyrazole |
| MFCD08060999 |