2-(4-Chlorophenoxy)-6-fluorobenzaldehyde structure
|
Common Name | 2-(4-Chlorophenoxy)-6-fluorobenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 902836-82-2 | Molecular Weight | 250.65300 | |
| Density | 1.334g/cm3 | Boiling Point | 327.9ºC at 760 mmHg | |
| Molecular Formula | C13H8ClFO2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 132ºC | |
| Name | 2-(4-Chlorophenoxy)-6-fluorobenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.334g/cm3 |
|---|---|
| Boiling Point | 327.9ºC at 760 mmHg |
| Molecular Formula | C13H8ClFO2 |
| Molecular Weight | 250.65300 |
| Flash Point | 132ºC |
| Exact Mass | 250.02000 |
| PSA | 26.30000 |
| LogP | 4.08390 |
| Index of Refraction | 1.6 |
| InChIKey | JEPXYNGAXLVUMW-UHFFFAOYSA-N |
| SMILES | O=Cc1c(F)cccc1Oc1ccc(Cl)cc1 |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| MFCD08061024 |
| 2-(4-Chloro-Phenoxy)-6-Fluoro-Benzaldehyde |
| 2-(2-FLUOROPHENOXY)PROPANOIC ACID |