2,5-Bis(1,1,3,3-tetramethylbutyl)hydroquinone structure
|
Common Name | 2,5-Bis(1,1,3,3-tetramethylbutyl)hydroquinone | ||
|---|---|---|---|---|
| CAS Number | 903-19-5 | Molecular Weight | 334.53600 | |
| Density | 0.95 g/cm3 | Boiling Point | 432.3ºC at 760 mmHg | |
| Molecular Formula | C22H38O2 | Melting Point | 130 °C | |
| MSDS | N/A | Flash Point | 181ºC | |
| Name | 2,5-Bis(1,1,3,3-tetramethylbutyl)hydroquinone |
|---|---|
| Synonym | More Synonyms |
| Density | 0.95 g/cm3 |
|---|---|
| Boiling Point | 432.3ºC at 760 mmHg |
| Melting Point | 130 °C |
| Molecular Formula | C22H38O2 |
| Molecular Weight | 334.53600 |
| Flash Point | 181ºC |
| Exact Mass | 334.28700 |
| PSA | 40.46000 |
| LogP | 6.52540 |
| Index of Refraction | 1.502 |
| InChIKey | CLDZVCMRASJQFO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(C)(C)c1cc(O)c(C(C)(C)CC(C)(C)C)cc1O |
| Storage condition | 2-8°C |
| Risk Phrases | R36/37/38 |
|---|---|
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2907299090 |
|
~%
2,5-Bis(1,1,3,3... CAS#:903-19-5 |
| Literature: Collection of Czechoslovak Chemical Communications, , vol. 29, p. 381 - 389 |
|
~%
2,5-Bis(1,1,3,3... CAS#:903-19-5 |
| Literature: Collection of Czechoslovak Chemical Communications, , vol. 29, p. 381 - 389 |
|
~%
2,5-Bis(1,1,3,3... CAS#:903-19-5 |
| Literature: Collection of Czechoslovak Chemical Communications, , vol. 29, p. 381 - 389 |
|
~%
2,5-Bis(1,1,3,3... CAS#:903-19-5 |
| Literature: Collection of Czechoslovak Chemical Communications, , vol. 29, p. 381 - 389 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| MFCD00128797 |
| 2,5-Di-tert-octyl-1,4-dihydroxybenzene |
| BistetraMethylbutylhydroquinone |
| HYDROQUINONE-BIS(1,1,3,3-TETRAMETHYLBUTYL) |
| EINECS 212-990-3 |
| 2,5-Bis(1,1,3,3-tetramethylbutyl)hydrquinone |
| 2,5-di-tert-octyl-hydroquinone |
| 2,5-Bis(2,4,4-trimethylpentan-2-yl)benzene-1,4-diol |
| 2,5-Di-tert.-octyl-hydrochinon |
| 2,4-DICHLORO-5-CHLOROSULFONYL-BENZOIC ACID |
| 4-Benzenediol,2,5-bis(1,1,3,3-tetramethylbutyl)-1 |
| 2,5-bis(1,1,3,3-tetramethylbutyl)-4-benzenediol |
| 2,5-Bis(1,1,3,3-tetramethylbutyl)hydrochinon |
| bistetramethylbutylhydrquinone |