Phosphonic acid, 1,3,5-triazine-2,4,6-triyltris-, hexamethyl ester structure
|
Common Name | Phosphonic acid, 1,3,5-triazine-2,4,6-triyltris-, hexamethyl ester | ||
|---|---|---|---|---|
| CAS Number | 903-22-0 | Molecular Weight | 405.17500 | |
| Density | 1.44g/cm3 | Boiling Point | 486.5ºC at 760 mmHg | |
| Molecular Formula | C9H18N3O9P3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.1ºC | |
| Name | 2,4,6-tris(dimethoxyphosphoryl)-1,3,5-triazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 486.5ºC at 760 mmHg |
| Molecular Formula | C9H18N3O9P3 |
| Molecular Weight | 405.17500 |
| Flash Point | 248.1ºC |
| Exact Mass | 405.02600 |
| PSA | 174.69000 |
| LogP | 0.20520 |
| Index of Refraction | 1.471 |
| InChIKey | MHSPHCZQMJJENS-UHFFFAOYSA-N |
| SMILES | COP(=O)(OC)c1nc(P(=O)(OC)OC)nc(P(=O)(OC)OC)n1 |
|
~%
Phosphonic acid... CAS#:903-22-0 |
| Literature: Morrison Journal of Organic Chemistry, 1957 , vol. 22, p. 444 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2.4.6-Tris-dimethoxyphosphinyl-1.3.5-triazin |
| Phosphonic acid,1,3,5-triazine-2,4,6-triyltris-,hexamethyl ester |