4-(2-Nitro-Phenyl)-Thiazol-2-Ylamine structure
|
Common Name | 4-(2-Nitro-Phenyl)-Thiazol-2-Ylamine | ||
|---|---|---|---|---|
| CAS Number | 90323-06-1 | Molecular Weight | 221.236 | |
| Density | 1.459 | Boiling Point | 429.8±20.0 °C at 760 mmHg | |
| Molecular Formula | C9H7N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.7±21.8 °C | |
| Name | 4-(2-Nitrophenyl)thiazole-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.459 |
|---|---|
| Boiling Point | 429.8±20.0 °C at 760 mmHg |
| Molecular Formula | C9H7N3O2S |
| Molecular Weight | 221.236 |
| Flash Point | 213.7±21.8 °C |
| Exact Mass | 221.025894 |
| PSA | 112.97000 |
| LogP | 1.68 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.693 |
| InChIKey | JJERKMNYIBNFTE-UHFFFAOYSA-N |
| SMILES | Nc1nc(-c2ccccc2[N+](=O)[O-])cs1 |
| HS Code | 2934100090 |
|---|
|
~87%
4-(2-Nitro-Phen... CAS#:90323-06-1 |
| Literature: Breinholt; Jeppesen; Branner; Olsen; Moller; Nielsen; Andersen Journal of Heterocyclic Chemistry, 2001 , vol. 38, # 3 p. 569 - 577 |
|
~%
4-(2-Nitro-Phen... CAS#:90323-06-1 |
| Literature: Chemical & Pharmaceutical Bulletin, , vol. 43, # 9 p. 1497 - 1504 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4-(2-Nitrophenyl)-1,3-thiazol-2-amine |
| 2-Thiazolamine, 4-(2-nitrophenyl)- |
| 4-(2-Nitro-Phenyl)-Thiazol-2-Ylamine |
| 4-(2-Nitrophenyl)-2-thiazolamine |