9H-Purine,2,6-dichloro-9-(tetrahydro-2-furanyl) structure
|
Common Name | 9H-Purine,2,6-dichloro-9-(tetrahydro-2-furanyl) | ||
|---|---|---|---|---|
| CAS Number | 90348-54-2 | Molecular Weight | 259.09200 | |
| Density | 1.82g/cm3 | Boiling Point | 406ºC at 760mmHg | |
| Molecular Formula | C9H8Cl2N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.4ºC | |
| Name | 2,6-dichloro-9-(oxolan-2-yl)purine |
|---|
| Density | 1.82g/cm3 |
|---|---|
| Boiling Point | 406ºC at 760mmHg |
| Molecular Formula | C9H8Cl2N4O |
| Molecular Weight | 259.09200 |
| Flash Point | 199.4ºC |
| Exact Mass | 258.00800 |
| PSA | 52.83000 |
| LogP | 2.44210 |
| Index of Refraction | 1.788 |
| InChIKey | MRCRQUGOOQUHKF-UHFFFAOYSA-N |
| SMILES | Clc1nc(Cl)c2ncn(C3CCCO3)c2n1 |
|
~88%
9H-Purine,2,6-d... CAS#:90348-54-2 |
| Literature: Hasan, Ahmad; Pratap, Ram; George, C. X.; Bhakuni, D. S. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1986 , vol. 25, p. 1070 - 1071 |
|
~92%
9H-Purine,2,6-d... CAS#:90348-54-2 |
| Literature: Guo, Hai-Ming; Xia, Chao; Niu, Hong-Ying; Zhang, Xiao-Ting; Kong, Si-Nan; Wang, Dong-Chao; Qu, Gui-Rong Advanced Synthesis and Catalysis, 2011 , vol. 353, # 1 p. 53 - 56 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |