Ethanone,2-(acetyloxy)-1-[4-(acetyloxy)-3,5-dimethoxyphenyl]- structure
|
Common Name | Ethanone,2-(acetyloxy)-1-[4-(acetyloxy)-3,5-dimethoxyphenyl]- | ||
|---|---|---|---|---|
| CAS Number | 90426-23-6 | Molecular Weight | 296.27300 | |
| Density | 1.218g/cm3 | Boiling Point | 376.2ºC at 760mmHg | |
| Molecular Formula | C14H16O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.3ºC | |
| Name | [2-(4-acetyloxy-3,5-dimethoxyphenyl)-2-oxoethyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.218g/cm3 |
|---|---|
| Boiling Point | 376.2ºC at 760mmHg |
| Molecular Formula | C14H16O7 |
| Molecular Weight | 296.27300 |
| Flash Point | 164.3ºC |
| Exact Mass | 296.09000 |
| PSA | 88.13000 |
| LogP | 1.37490 |
| Index of Refraction | 1.504 |
| InChIKey | VAWIPXWTWCLILT-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)COC(C)=O)cc(OC)c1OC(C)=O |
|
~%
Ethanone,2-(ace... CAS#:90426-23-6 |
| Literature: Levy; Posternack; Robinson Journal of the Chemical Society, 1931 , p. 2701,2707 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 2,4'-di-O-acetylhydroxyacetosiringone |
| danielone 2,4'-diacetate |