3,6-dimethyl-5-prop-2-enyl-1H-pyrimidine-2,4-dione structure
|
Common Name | 3,6-dimethyl-5-prop-2-enyl-1H-pyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 90437-63-1 | Molecular Weight | 180.20400 | |
| Density | 1.092g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,6-dimethyl-5-prop-2-enyl-1H-pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.092g/cm3 |
|---|---|
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.20400 |
| Exact Mass | 180.09000 |
| PSA | 55.12000 |
| LogP | 0.52280 |
| Index of Refraction | 1.497 |
| InChIKey | IPJAPJKGXQNESJ-UHFFFAOYSA-N |
| SMILES | C=CCc1c(C)[nH]c(=O)n(C)c1=O |
|
~%
3,6-dimethyl-5-... CAS#:90437-63-1 |
| Literature: Senda; Suzui Chemical and Pharmaceutical Bulletin, 1958 , vol. 6, p. 476,478 |
|
~%
3,6-dimethyl-5-... CAS#:90437-63-1 |
| Literature: Senda; Suzui Chemical and Pharmaceutical Bulletin, 1958 , vol. 6, p. 476,478 |
| Uracil,5-allyl-3,6-dimethyl |
| 5-allyl-3,6-dimethyl-1H-pyrimidine-2,4-dione |
| 5-Allyl-3,6-dimethyl-1H-pyrimidin-2,4-dion |
| 5-Allyl-3,6-dimethyluracil |