Silane, dimethyl-phenyl-(tert-butyl)- structure
|
Common Name | Silane, dimethyl-phenyl-(tert-butyl)- | ||
|---|---|---|---|---|
| CAS Number | 90467-12-2 | Molecular Weight | 192.37300 | |
| Density | 0.85g/cm3 | Boiling Point | 230.2ºC at 760 mmHg | |
| Molecular Formula | C12H20Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 78.5ºC | |
| Name | tert-butyl-dimethyl-phenylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.85g/cm3 |
|---|---|
| Boiling Point | 230.2ºC at 760 mmHg |
| Molecular Formula | C12H20Si |
| Molecular Weight | 192.37300 |
| Flash Point | 78.5ºC |
| Exact Mass | 192.13300 |
| LogP | 3.40210 |
| Index of Refraction | 1.475 |
| InChIKey | LHBSHRHABGHGRB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)c1ccccc1 |
|
~67%
Silane, dimethy... CAS#:90467-12-2 |
| Literature: Raddo, Pasquale Di; Diksic, Mirko; Jolly, Dean Journal of the Chemical Society, Chemical Communications, 1984 , # 3 p. 159 - 160 |
| tert-butyldimethylphenylsilane |
| Silane,dimethyl-phenyl-(tert-butyl) |