dimethyl-phenyl-tert-butyl-germane structure
|
Common Name | dimethyl-phenyl-tert-butyl-germane | ||
|---|---|---|---|---|
| CAS Number | 94397-45-2 | Molecular Weight | 236.92700 | |
| Density | N/A | Boiling Point | 239.4ºC at 760mmHg | |
| Molecular Formula | C12H20Ge | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 91.6ºC | |
| Name | tert-butyl-dimethyl-phenylgermane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 239.4ºC at 760mmHg |
|---|---|
| Molecular Formula | C12H20Ge |
| Molecular Weight | 236.92700 |
| Flash Point | 91.6ºC |
| Exact Mass | 238.07800 |
| LogP | 4.02770 |
| InChIKey | IZQZJPWWOLADHT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Ge](C)(C)c1ccccc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Germane,dimethyl-phenyl-(tert-butyl) |
| DIMETHYL-PHENYL-TERT-BUTYL-GERMANE |