4-(4-chloro-2-fluoroanilino)-4-oxobutanoic acid
Modify Date: 2025-09-01 18:31:34
4-(4-chloro-2-fluoroanilino)-4-oxobutanoic acid structure
|
Common Name | 4-(4-chloro-2-fluoroanilino)-4-oxobutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 904810-52-2 | Molecular Weight | 245.63500 | |
| Density | 1.476g/cm3 | Boiling Point | 462.3ºC at 760 mmHg | |
| Molecular Formula | C10H9ClFNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.4ºC | |
| Name | 4-(4-chloro-2-fluoroanilino)-4-oxobutanoic acid |
|---|
| Density | 1.476g/cm3 |
|---|---|
| Boiling Point | 462.3ºC at 760 mmHg |
| Molecular Formula | C10H9ClFNO3 |
| Molecular Weight | 245.63500 |
| Flash Point | 233.4ºC |
| Exact Mass | 245.02500 |
| PSA | 66.40000 |
| LogP | 2.35540 |
| Index of Refraction | 1.591 |
| InChIKey | IAXPBKWZXXEWQX-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(=O)Nc1ccc(Cl)cc1F |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |