4-(4-chloro-3-fluorophenyl)-4-oxobutanoic acid structure
|
Common Name | 4-(4-chloro-3-fluorophenyl)-4-oxobutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 142048-54-2 | Molecular Weight | 230.62000 | |
| Density | 1.399g/cm3 | Boiling Point | 417.8ºC at 760mmHg | |
| Molecular Formula | C10H8ClFO3 | Melting Point | 145-148ºC | |
| MSDS | N/A | Flash Point | 206.5ºC | |
| Name | 4-(4-chloro-3-fluorophenyl)-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.399g/cm3 |
|---|---|
| Boiling Point | 417.8ºC at 760mmHg |
| Melting Point | 145-148ºC |
| Molecular Formula | C10H8ClFO3 |
| Molecular Weight | 230.62000 |
| Flash Point | 206.5ºC |
| Exact Mass | 230.01500 |
| PSA | 54.37000 |
| LogP | 2.52660 |
| Vapour Pressure | 9.99E-08mmHg at 25°C |
| Index of Refraction | 1.543 |
| InChIKey | IRQZAGWHZPBKOD-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(=O)c1ccc(Cl)c(F)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| HS Code | 2918300090 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Benzenebutanoic acid,4-chloro-3-fluoro-g-oxo |
| 4-(4-Chloro-3-fluorophenyl)-4-oxobutyric acid |
| PC5288 |