2-phenylquinoxaline-5-carboxylic acid
Modify Date: 2025-09-15 16:42:37
2-phenylquinoxaline-5-carboxylic acid structure
|
Common Name | 2-phenylquinoxaline-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 904813-44-1 | Molecular Weight | 250.25200 | |
| Density | 1.332g/cm3 | Boiling Point | 486ºC at 760 mmHg | |
| Molecular Formula | C15H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.7ºC | |
| Name | 2-phenylquinoxaline-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.332g/cm3 |
|---|---|
| Boiling Point | 486ºC at 760 mmHg |
| Molecular Formula | C15H10N2O2 |
| Molecular Weight | 250.25200 |
| Flash Point | 247.7ºC |
| Exact Mass | 250.07400 |
| PSA | 63.08000 |
| LogP | 2.99500 |
| Index of Refraction | 1.69 |
| InChIKey | SOSPLSWNVQCOCL-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc2nc(-c3ccccc3)cnc12 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| gl-0109 |