4-hydroxy-4-(3-hydroxyphenyl)-2-oxobut-3-enoic acid structure
|
Common Name | 4-hydroxy-4-(3-hydroxyphenyl)-2-oxobut-3-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 904814-38-6 | Molecular Weight | 208.16800 | |
| Density | 1.508g/cm3 | Boiling Point | 447.4ºC at 760mmHg | |
| Molecular Formula | C10H8O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.5ºC | |
| Name | 4-hydroxy-4-(3-hydroxyphenyl)-2-oxobut-3-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.508g/cm3 |
|---|---|
| Boiling Point | 447.4ºC at 760mmHg |
| Molecular Formula | C10H8O5 |
| Molecular Weight | 208.16800 |
| Flash Point | 238.5ºC |
| Exact Mass | 208.03700 |
| PSA | 94.83000 |
| LogP | 0.94480 |
| Index of Refraction | 1.651 |
| InChIKey | BKMYVWDEXQTAGB-UHFFFAOYSA-N |
| SMILES | O=C(O)C(=O)C=C(O)c1cccc(O)c1 |
| Hazard Codes | C: Corrosive; |
|---|---|
| HS Code | 2918990090 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Hydroxy-4-(3-hydroxy-phenyl)-2-oxo-but-3-enoic acid |