6-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyridine-3-carboxylic acid structure
|
Common Name | 6-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyridine-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 904815-08-3 | Molecular Weight | 281.30800 | |
| Density | 1.244g/cm3 | Boiling Point | 503.9ºC at 760 mmHg | |
| Molecular Formula | C13H19N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.6ºC | |
| Name | 6-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pyridine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.244g/cm3 |
|---|---|
| Boiling Point | 503.9ºC at 760 mmHg |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.30800 |
| Flash Point | 258.6ºC |
| Exact Mass | 281.13800 |
| PSA | 100.55000 |
| LogP | 2.18030 |
| Index of Refraction | 1.568 |
| InChIKey | IESPTOAZDMOCON-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCNc1ccc(C(=O)O)cn1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-(2-tert-Butoxycarbonylaminoethylamino)nicotinic acid |
| GL-0227 |