2-naphthalen-1-ylquinoxaline-5-carboxylic acid
Modify Date: 2025-09-10 11:06:37
2-naphthalen-1-ylquinoxaline-5-carboxylic acid structure
|
Common Name | 2-naphthalen-1-ylquinoxaline-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 904818-39-9 | Molecular Weight | 300.31100 | |
| Density | 1.353g/cm3 | Boiling Point | 540ºC at 760mmHg | |
| Molecular Formula | C19H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.4ºC | |
| Name | 2-naphthalen-1-ylquinoxaline-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.353g/cm3 |
|---|---|
| Boiling Point | 540ºC at 760mmHg |
| Molecular Formula | C19H12N2O2 |
| Molecular Weight | 300.31100 |
| Flash Point | 280.4ºC |
| Exact Mass | 300.09000 |
| PSA | 63.08000 |
| LogP | 4.14820 |
| Index of Refraction | 1.741 |
| InChIKey | QYXUILKEDCALRC-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc2nc(-c3cccc4ccccc34)cnc12 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Quinoxalinecarboxylicacid,2-(1-naphthalenyl) |
| 2-(Naphth-1-yl)quinoxaline-5-carboxylic acid |
| GL-0362 |