4,4,8,8-tetrabromotricyclo[5.1.0.03,5]octane structure
|
Common Name | 4,4,8,8-tetrabromotricyclo[5.1.0.03,5]octane | ||
|---|---|---|---|---|
| CAS Number | 90528-07-7 | Molecular Weight | 423.76500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8Br4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,4,8,8-tetrabromotricyclo[5.1.0.03,5]octane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H8Br4 |
|---|---|
| Molecular Weight | 423.76500 |
| Exact Mass | 419.73600 |
| LogP | 4.24440 |
| InChIKey | USRKBDHJSJGLJJ-UHFFFAOYSA-N |
| SMILES | BrC1(Br)C2CC3C(CC21)C3(Br)Br |
|
~%
4,4,8,8-tetrabr... CAS#:90528-07-7 |
| Literature: Winstein,S.; Sonnenberg,J. Journal of the American Chemical Society, 1961 , vol. 83, p. 3235 - 3244 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 7,7,8,8-Tetrabrom-tricyclo<4.1.0.4'.1'.0'>octan |
| 4,4,8,8-Tetrabrom-tricyclo<5.1.0.03,5>octan |